C21H18BrNO2 — CID 2952126
N-[(4-bromophenyl)-phenylmethyl]-3-methoxybenzamide (PubChem CID 2952126) has the molecular formula C21H18BrNO2 and a molecular weight of 396.28 g/mol. Its IUPAC name is N-[(4-bromophenyl)-phenylmethyl]-3-methoxybenzamide.
| Compound Name | N-[(4-bromophenyl)-phenylmethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 2952126 |
| Molecular Formula | C21H18BrNO2 |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | N-[(4-bromophenyl)-phenylmethyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NC(c2ccccc2)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C21H18BrNO2/c1-25-19-9-5-8-17(14-19)21(24)23-20(15-6-3-2-4-7-15)16-10-12-18(22)13-11-16/h2-14,20H,1H3,(H,23,24) |
| InChIKey | UZNUUXOTNVDAQH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |