C18H14N2O2S — CID 2952135
1-benzoyl-3-(2-furyl)-5-(2-thienyl)-4,5-dihydro-1H-pyrazole (PubChem CID 2952135) has the molecular formula C18H14N2O2S and a molecular weight of 322.40 g/mol. Its IUPAC name is [5-(furan-2-yl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-phenylmethanone.
| Compound Name | 1-benzoyl-3-(2-furyl)-5-(2-thienyl)-4,5-dihydro-1H-pyrazole |
|---|---|
| PubChem CID | 2952135 |
| Molecular Formula | C18H14N2O2S |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | [5-(furan-2-yl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-phenylmethanone |
| SMILES | C1C(N(N=C1C2=CC=CO2)C(=O)C3=CC=CC=C3)C4=CC=CS4 |
| InChI | InChI=1S/C18H14N2O2S/c21-18(13-6-2-1-3-7-13)20-15(17-9-5-11-23-17)12-14(19-20)16-8-4-10-22-16/h1-11,15H,12H2 |
| InChIKey | NXXDDNZTHMUWJN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 74.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | 476 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |