About 2-(benzenesulfonyl)-3,5-diphenyl-3,4-dihydropyrazole
2-(benzenesulfonyl)-3,5-diphenyl-3,4-dihydropyrazole (PubChem CID 2952925) has the molecular formula C21H18N2O2S
and a molecular weight of 362.45 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-3,5-diphenyl-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | 2-(benzenesulfonyl)-3,5-diphenyl-3,4-dihydropyrazole |
| PubChem CID | 2952925 |
| Molecular Formula | C21H18N2O2S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 2-(benzenesulfonyl)-3,5-diphenyl-3,4-dihydropyrazole |
| SMILES | O=S(=O)(c1ccccc1)N1N=C(c2ccccc2)CC1c1ccccc1 |
| InChI | InChI=1S/C21H18N2O2S/c24-26(25,19-14-8-3-9-15-19)23-21(18-12-6-2-7-13-18)16-20(22-23)17-10-4-1-5-11-17/h1-15,21H,16H2 |
| InChIKey | LVKSEIDGIPEKPU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(benzenesulfonyl)-3,5-diphenyl-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyl)-3,5-diphenyl-3,4-dihydropyrazole?
The IUPAC name of 2-(benzenesulfonyl)-3,5-diphenyl-3,4-dihydropyrazole (CID 2952925) is 2-(benzenesulfonyl)-3,5-diphenyl-3,4-dihydropyrazole.
What is the SMILES notation for 2-(benzenesulfonyl)-3,5-diphenyl-3,4-dihydropyrazole?
The canonical SMILES for 2-(benzenesulfonyl)-3,5-diphenyl-3,4-dihydropyrazole is O=S(=O)(c1ccccc1)N1N=C(c2ccccc2)CC1c1ccccc1.
What is the InChIKey of 2-(benzenesulfonyl)-3,5-diphenyl-3,4-dihydropyrazole?
The InChIKey is LVKSEIDGIPEKPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O2S/c24-26(25,19-14-8-3-9-15-19)23-21(18-12-6-2-7-13-18)16-20(22-23)17-10-4-1-5-11-17/h1-15,21H,16H2.
What are the key properties of 2-(benzenesulfonyl)-3,5-diphenyl-3,4-dihydropyrazole?
2-(benzenesulfonyl)-3,5-diphenyl-3,4-dihydropyrazole has a molecular weight of 362.45 g/mol, XLogP of 4.23, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyl)-3,5-diphenyl-3,4-dihydropyrazole is sourced from PubChem (CID 2952925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).