About (1-methylpiperidin-4-yl) furan-2-carboxylate;hydrochloride
(1-methylpiperidin-4-yl) furan-2-carboxylate;hydrochloride (PubChem CID 2952941) has the molecular formula C11H16ClNO3
and a molecular weight of 245.71 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) furan-2-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | (1-methylpiperidin-4-yl) furan-2-carboxylate;hydrochloride |
| PubChem CID | 2952941 |
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | (1-methylpiperidin-4-yl) furan-2-carboxylate;hydrochloride |
| SMILES | CN1CCC(OC(=O)c2ccco2)CC1.Cl |
| InChI | InChI=1S/C11H15NO3.ClH/c1-12-6-4-9(5-7-12)15-11(13)10-3-2-8-14-10;/h2-3,8-9H,4-7H2,1H3;1H |
| InChIKey | WGSCMAWQWBAFBW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-methylpiperidin-4-yl) furan-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-4-yl) furan-2-carboxylate;hydrochloride?
The IUPAC name of (1-methylpiperidin-4-yl) furan-2-carboxylate;hydrochloride (CID 2952941) is (1-methylpiperidin-4-yl) furan-2-carboxylate;hydrochloride.
What is the SMILES notation for (1-methylpiperidin-4-yl) furan-2-carboxylate;hydrochloride?
The canonical SMILES for (1-methylpiperidin-4-yl) furan-2-carboxylate;hydrochloride is CN1CCC(OC(=O)c2ccco2)CC1.Cl.
What is the InChIKey of (1-methylpiperidin-4-yl) furan-2-carboxylate;hydrochloride?
The InChIKey is WGSCMAWQWBAFBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3.ClH/c1-12-6-4-9(5-7-12)15-11(13)10-3-2-8-14-10;/h2-3,8-9H,4-7H2,1H3;1H.
What are the key properties of (1-methylpiperidin-4-yl) furan-2-carboxylate;hydrochloride?
(1-methylpiperidin-4-yl) furan-2-carboxylate;hydrochloride has a molecular weight of 245.71 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-4-yl) furan-2-carboxylate;hydrochloride is sourced from PubChem (CID 2952941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).