C29H30N4O5S — CID 2953317
2-[[3-cyano-7,7-dimethyl-4-(3-nitrophenyl)-5-oxo-1,4,6,8-tetrahydroquinolin-2-yl]sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide (PubChem CID 2953317) has the molecular formula C29H30N4O5S and a molecular weight of 546.65 g/mol. Its IUPAC name is 2-[[3-cyano-7,7-dimethyl-4-(3-nitrophenyl)-5-oxo-1,4,6,8-tetrahydroquinolin-2-yl]sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[[3-cyano-7,7-dimethyl-4-(3-nitrophenyl)-5-oxo-1,4,6,8-tetrahydroquinolin-2-yl]sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 2953317 |
| Molecular Formula | C29H30N4O5S |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | 2-[[3-cyano-7,7-dimethyl-4-(3-nitrophenyl)-5-oxo-1,4,6,8-tetrahydroquinolin-2-yl]sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(CCNC(=O)CSC2=C(C#N)C(c3cccc([N+](=O)[O-])c3)C3=C(CC(C)(C)CC3=O)N2)cc1 |
| InChI | InChI=1S/C29H30N4O5S/c1-29(2)14-23-27(24(34)15-29)26(19-5-4-6-20(13-19)33(36)37)22(16-30)28(32-23)39-17-25(35)31-12-11-18-7-9-21(38-3)10-8-18/h4-10,13,26,32H,11-12,14-15,17H2,1-3H3,(H,31,35) |
| InChIKey | WXZIIBNNUYRBGF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 134.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|