C18H18ClF2N3O3 — CID 2954215
1-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]-3-(2,4-difluorophenyl)urea (PubChem CID 2954215) has the molecular formula C18H18ClF2N3O3 and a molecular weight of 397.81 g/mol. Its IUPAC name is 1-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 2954215 |
| Molecular Formula | C18H18ClF2N3O3 |
| Molecular Weight | 397.81 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 1-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]-3-(2,4-difluorophenyl)urea |
| SMILES | Cc1cc(OC(C)C(=O)NNC(=O)Nc2ccc(F)cc2F)cc(C)c1Cl |
| InChI | InChI=1S/C18H18ClF2N3O3/c1-9-6-13(7-10(2)16(9)19)27-11(3)17(25)23-24-18(26)22-15-5-4-12(20)8-14(15)21/h4-8,11H,1-3H3,(H,23,25)(H2,22,24,26) |
| InChIKey | KNSWIKBFSBLVPB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.81 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|