C20H25N3O5 — CID 2955101
1-[(3-butoxybenzoyl)amino]-3-(3,4-dimethoxyphenyl)urea (PubChem CID 2955101) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is 1-[(3-butoxybenzoyl)amino]-3-(3,4-dimethoxyphenyl)urea.
| Compound Name | 1-[(3-butoxybenzoyl)amino]-3-(3,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 2955101 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 1-[(3-butoxybenzoyl)amino]-3-(3,4-dimethoxyphenyl)urea |
| SMILES | CCCCOc1cccc(C(=O)NNC(=O)Nc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C20H25N3O5/c1-4-5-11-28-16-8-6-7-14(12-16)19(24)22-23-20(25)21-15-9-10-17(26-2)18(13-15)27-3/h6-10,12-13H,4-5,11H2,1-3H3,(H,22,24)(H2,21,23,25) |
| InChIKey | OHTINKVROYDCQT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|