About bis(4-aminophenyl) carbonate
bis(4-aminophenyl) carbonate (PubChem CID 29555) has the molecular formula C13H12N2O3
and a molecular weight of 244.25 g/mol. Its IUPAC name is bis(4-aminophenyl) carbonate.
Molecular Properties
| Compound Name | bis(4-aminophenyl) carbonate |
| PubChem CID | 29555 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | bis(4-aminophenyl) carbonate |
| SMILES | Nc1ccc(OC(=O)Oc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C13H12N2O3/c14-9-1-5-11(6-2-9)17-13(16)18-12-7-3-10(15)4-8-12/h1-8H,14-15H2 |
| InChIKey | JBBBDGJYVDMMMN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze bis(4-aminophenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-aminophenyl) carbonate?
The IUPAC name of bis(4-aminophenyl) carbonate (CID 29555) is bis(4-aminophenyl) carbonate.
What is the SMILES notation for bis(4-aminophenyl) carbonate?
The canonical SMILES for bis(4-aminophenyl) carbonate is Nc1ccc(OC(=O)Oc2ccc(N)cc2)cc1.
What is the InChIKey of bis(4-aminophenyl) carbonate?
The InChIKey is JBBBDGJYVDMMMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O3/c14-9-1-5-11(6-2-9)17-13(16)18-12-7-3-10(15)4-8-12/h1-8H,14-15H2.
What are the key properties of bis(4-aminophenyl) carbonate?
bis(4-aminophenyl) carbonate has a molecular weight of 244.25 g/mol, XLogP of 2.43, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-aminophenyl) carbonate is sourced from PubChem (CID 29555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).