About 1-[4-(3,5-dimethyladamantane-1-carbonyl)piperazin-1-yl]ethanone
1-[4-(3,5-dimethyladamantane-1-carbonyl)piperazin-1-yl]ethanone (PubChem CID 2955840) has the molecular formula C19H30N2O2
and a molecular weight of 318.46 g/mol. Its IUPAC name is 1-[4-(3,5-dimethyladamantane-1-carbonyl)piperazin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(3,5-dimethyladamantane-1-carbonyl)piperazin-1-yl]ethanone |
| PubChem CID | 2955840 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 1-[4-(3,5-dimethyladamantane-1-carbonyl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)C23CC4CC(C)(CC(C)(C4)C2)C3)CC1 |
| InChI | InChI=1S/C19H30N2O2/c1-14(22)20-4-6-21(7-5-20)16(23)19-10-15-8-17(2,12-19)11-18(3,9-15)13-19/h15H,4-13H2,1-3H3 |
| InChIKey | TXXDFVIPKURLPS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4-(3,5-dimethyladamantane-1-carbonyl)piperazin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3,5-dimethyladamantane-1-carbonyl)piperazin-1-yl]ethanone?
The IUPAC name of 1-[4-(3,5-dimethyladamantane-1-carbonyl)piperazin-1-yl]ethanone (CID 2955840) is 1-[4-(3,5-dimethyladamantane-1-carbonyl)piperazin-1-yl]ethanone.
What is the SMILES notation for 1-[4-(3,5-dimethyladamantane-1-carbonyl)piperazin-1-yl]ethanone?
The canonical SMILES for 1-[4-(3,5-dimethyladamantane-1-carbonyl)piperazin-1-yl]ethanone is CC(=O)N1CCN(C(=O)C23CC4CC(C)(CC(C)(C4)C2)C3)CC1.
What is the InChIKey of 1-[4-(3,5-dimethyladamantane-1-carbonyl)piperazin-1-yl]ethanone?
The InChIKey is TXXDFVIPKURLPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2O2/c1-14(22)20-4-6-21(7-5-20)16(23)19-10-15-8-17(2,12-19)11-18(3,9-15)13-19/h15H,4-13H2,1-3H3.
What are the key properties of 1-[4-(3,5-dimethyladamantane-1-carbonyl)piperazin-1-yl]ethanone?
1-[4-(3,5-dimethyladamantane-1-carbonyl)piperazin-1-yl]ethanone has a molecular weight of 318.46 g/mol, XLogP of 2.67, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3,5-dimethyladamantane-1-carbonyl)piperazin-1-yl]ethanone is sourced from PubChem (CID 2955840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).