C16H15N5O5 — CID 2955848
N-(1,3-benzodioxol-5-yl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide (PubChem CID 2955848) has the molecular formula C16H15N5O5 and a molecular weight of 357.33 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide |
|---|---|
| PubChem CID | 2955848 |
| Molecular Formula | C16H15N5O5 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)Nc2ccc3c(c2)OCO3)n(C)c1=O |
| InChI | InChI=1S/C16H15N5O5/c1-19-14-13(15(23)20(2)16(19)24)21(7-17-14)6-12(22)18-9-3-4-10-11(5-9)26-8-25-10/h3-5,7H,6,8H2,1-2H3,(H,18,22) |
| InChIKey | DIRBTUBCJXDOHR-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |