About 1-(1-adamantyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)urea
1-(1-adamantyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)urea (PubChem CID 2956027) has the molecular formula C19H24N2O3
and a molecular weight of 328.41 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)urea.
Molecular Properties
| Compound Name | 1-(1-adamantyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)urea |
| PubChem CID | 2956027 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 1-(1-adamantyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)urea |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H24N2O3/c22-18(20-15-1-2-16-17(8-15)24-4-3-23-16)21-19-9-12-5-13(10-19)7-14(6-12)11-19/h1-2,8,12-14H,3-7,9-11H2,(H2,20,21,22) |
| InChIKey | KGNFUQPAMPXCDD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1-adamantyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-adamantyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)urea?
The IUPAC name of 1-(1-adamantyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)urea (CID 2956027) is 1-(1-adamantyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)urea.
What is the SMILES notation for 1-(1-adamantyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)urea?
The canonical SMILES for 1-(1-adamantyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)urea is O=C(Nc1ccc2c(c1)OCCO2)NC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-(1-adamantyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)urea?
The InChIKey is KGNFUQPAMPXCDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O3/c22-18(20-15-1-2-16-17(8-15)24-4-3-23-16)21-19-9-12-5-13(10-19)7-14(6-12)11-19/h1-2,8,12-14H,3-7,9-11H2,(H2,20,21,22).
What are the key properties of 1-(1-adamantyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)urea?
1-(1-adamantyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)urea has a molecular weight of 328.41 g/mol, XLogP of 3.55, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-adamantyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)urea is sourced from PubChem (CID 2956027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).