About 2-(1,3-dimethyl-2,6-dioxopurin-9-yl)-N-(3-oxo-1H-2-benzofuran-5-yl)acetamide
2-(1,3-dimethyl-2,6-dioxopurin-9-yl)-N-(3-oxo-1H-2-benzofuran-5-yl)acetamide (PubChem CID 2956330) has the molecular formula C17H15N5O5
and a molecular weight of 369.34 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-9-yl)-N-(3-oxo-1H-2-benzofuran-5-yl)acetamide.
Molecular Properties
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-9-yl)-N-(3-oxo-1H-2-benzofuran-5-yl)acetamide |
| PubChem CID | 2956330 |
| Molecular Formula | C17H15N5O5 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-9-yl)-N-(3-oxo-1H-2-benzofuran-5-yl)acetamide |
| SMILES | Cn1c(=O)c2ncn(CC(=O)Nc3ccc4c(c3)C(=O)OC4)c2n(C)c1=O |
| InChI | InChI=1S/C17H15N5O5/c1-20-14-13(15(24)21(2)17(20)26)18-8-22(14)6-12(23)19-10-4-3-9-7-27-16(25)11(9)5-10/h3-5,8H,6-7H2,1-2H3,(H,19,23) |
| InChIKey | JATAQPNQGHDBSU-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 2-(1,3-dimethyl-2,6-dioxopurin-9-yl)-N-(3-oxo-1H-2-benzofuran-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dimethyl-2,6-dioxopurin-9-yl)-N-(3-oxo-1H-2-benzofuran-5-yl)acetamide?
The IUPAC name of 2-(1,3-dimethyl-2,6-dioxopurin-9-yl)-N-(3-oxo-1H-2-benzofuran-5-yl)acetamide (CID 2956330) is 2-(1,3-dimethyl-2,6-dioxopurin-9-yl)-N-(3-oxo-1H-2-benzofuran-5-yl)acetamide.
What is the SMILES notation for 2-(1,3-dimethyl-2,6-dioxopurin-9-yl)-N-(3-oxo-1H-2-benzofuran-5-yl)acetamide?
The canonical SMILES for 2-(1,3-dimethyl-2,6-dioxopurin-9-yl)-N-(3-oxo-1H-2-benzofuran-5-yl)acetamide is Cn1c(=O)c2ncn(CC(=O)Nc3ccc4c(c3)C(=O)OC4)c2n(C)c1=O.
What is the InChIKey of 2-(1,3-dimethyl-2,6-dioxopurin-9-yl)-N-(3-oxo-1H-2-benzofuran-5-yl)acetamide?
The InChIKey is JATAQPNQGHDBSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N5O5/c1-20-14-13(15(24)21(2)17(20)26)18-8-22(14)6-12(23)19-10-4-3-9-7-27-16(25)11(9)5-10/h3-5,8H,6-7H2,1-2H3,(H,19,23).
What are the key properties of 2-(1,3-dimethyl-2,6-dioxopurin-9-yl)-N-(3-oxo-1H-2-benzofuran-5-yl)acetamide?
2-(1,3-dimethyl-2,6-dioxopurin-9-yl)-N-(3-oxo-1H-2-benzofuran-5-yl)acetamide has a molecular weight of 369.34 g/mol, XLogP of -0.26, 3 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dimethyl-2,6-dioxopurin-9-yl)-N-(3-oxo-1H-2-benzofuran-5-yl)acetamide is sourced from PubChem (CID 2956330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).