About [4-(methoxycarbonylamino)thiolan-3-yl] 4-bromobenzoate
[4-(methoxycarbonylamino)thiolan-3-yl] 4-bromobenzoate (PubChem CID 2956424) has the molecular formula C13H14BrNO4S
and a molecular weight of 360.23 g/mol. Its IUPAC name is [4-(methoxycarbonylamino)thiolan-3-yl] 4-bromobenzoate.
Molecular Properties
| Compound Name | [4-(methoxycarbonylamino)thiolan-3-yl] 4-bromobenzoate |
| PubChem CID | 2956424 |
| Molecular Formula | C13H14BrNO4S |
| Molecular Weight | 360.23 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | [4-(methoxycarbonylamino)thiolan-3-yl] 4-bromobenzoate |
| SMILES | COC(=O)NC1CSCC1OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H14BrNO4S/c1-18-13(17)15-10-6-20-7-11(10)19-12(16)8-2-4-9(14)5-3-8/h2-5,10-11H,6-7H2,1H3,(H,15,17) |
| InChIKey | MSJQIJWBTUHVCV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.23 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(methoxycarbonylamino)thiolan-3-yl] 4-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(methoxycarbonylamino)thiolan-3-yl] 4-bromobenzoate?
The IUPAC name of [4-(methoxycarbonylamino)thiolan-3-yl] 4-bromobenzoate (CID 2956424) is [4-(methoxycarbonylamino)thiolan-3-yl] 4-bromobenzoate.
What is the SMILES notation for [4-(methoxycarbonylamino)thiolan-3-yl] 4-bromobenzoate?
The canonical SMILES for [4-(methoxycarbonylamino)thiolan-3-yl] 4-bromobenzoate is COC(=O)NC1CSCC1OC(=O)c1ccc(Br)cc1.
What is the InChIKey of [4-(methoxycarbonylamino)thiolan-3-yl] 4-bromobenzoate?
The InChIKey is MSJQIJWBTUHVCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrNO4S/c1-18-13(17)15-10-6-20-7-11(10)19-12(16)8-2-4-9(14)5-3-8/h2-5,10-11H,6-7H2,1H3,(H,15,17).
What are the key properties of [4-(methoxycarbonylamino)thiolan-3-yl] 4-bromobenzoate?
[4-(methoxycarbonylamino)thiolan-3-yl] 4-bromobenzoate has a molecular weight of 360.23 g/mol, XLogP of 2.45, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(methoxycarbonylamino)thiolan-3-yl] 4-bromobenzoate is sourced from PubChem (CID 2956424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).