C20H22N4O7S — CID 2957206
2-(N-methylsulfonyl-3-nitroanilino)-N-[2-(morpholine-4-carbonyl)phenyl]acetamide (PubChem CID 2957206) has the molecular formula C20H22N4O7S and a molecular weight of 462.48 g/mol. Its IUPAC name is 2-(N-methylsulfonyl-3-nitroanilino)-N-[2-(morpholine-4-carbonyl)phenyl]acetamide.
| Compound Name | 2-(N-methylsulfonyl-3-nitroanilino)-N-[2-(morpholine-4-carbonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 2957206 |
| Molecular Formula | C20H22N4O7S |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 2-(N-methylsulfonyl-3-nitroanilino)-N-[2-(morpholine-4-carbonyl)phenyl]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1ccccc1C(=O)N1CCOCC1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H22N4O7S/c1-32(29,30)23(15-5-4-6-16(13-15)24(27)28)14-19(25)21-18-8-3-2-7-17(18)20(26)22-9-11-31-12-10-22/h2-8,13H,9-12,14H2,1H3,(H,21,25) |
| InChIKey | MMEOSJMPWPWLSO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|