C12H2Cl6O2 — CID 29575
1,2,3,7,8,9-hexachlorodibenzo-p-dioxin (PubChem CID 29575) has the molecular formula C12H2Cl6O2 and a molecular weight of 390.86 g/mol. Its IUPAC name is 1,2,3,7,8,9-hexachlorodibenzo-p-dioxin.
| Compound Name | 1,2,3,7,8,9-hexachlorodibenzo-p-dioxin |
|---|---|
| PubChem CID | 29575 |
| Molecular Formula | C12H2Cl6O2 |
| Molecular Weight | 390.86 g/mol |
| Exact Mass | 387.82 |
| IUPAC Name | 1,2,3,7,8,9-hexachlorodibenzo-p-dioxin |
| SMILES | Clc1cc2c(c(Cl)c1Cl)Oc1c(cc(Cl)c(Cl)c1Cl)O2 |
| InChI | InChI=1S/C12H2Cl6O2/c13-3-1-5-11(9(17)7(3)15)20-12-6(19-5)2-4(14)8(16)10(12)18/h1-2H |
| InChIKey | LGIRBUBHIWTVCK-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.86 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|