About 3-(2,2-dimethyloxan-4-yl)-3-phenyl-N,N-dipropylpropanamide
3-(2,2-dimethyloxan-4-yl)-3-phenyl-N,N-dipropylpropanamide (PubChem CID 2957681) has the molecular formula C22H35NO2
and a molecular weight of 345.53 g/mol. Its IUPAC name is 3-(2,2-dimethyloxan-4-yl)-3-phenyl-N,N-dipropylpropanamide.
Molecular Properties
| Compound Name | 3-(2,2-dimethyloxan-4-yl)-3-phenyl-N,N-dipropylpropanamide |
| PubChem CID | 2957681 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | 3-(2,2-dimethyloxan-4-yl)-3-phenyl-N,N-dipropylpropanamide |
| SMILES | CCCN(CCC)C(=O)CC(c1ccccc1)C1CCOC(C)(C)C1 |
| InChI | InChI=1S/C22H35NO2/c1-5-13-23(14-6-2)21(24)16-20(18-10-8-7-9-11-18)19-12-15-25-22(3,4)17-19/h7-11,19-20H,5-6,12-17H2,1-4H3 |
| InChIKey | XQPCADCBGDOLFB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2,2-dimethyloxan-4-yl)-3-phenyl-N,N-dipropylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-dimethyloxan-4-yl)-3-phenyl-N,N-dipropylpropanamide?
The IUPAC name of 3-(2,2-dimethyloxan-4-yl)-3-phenyl-N,N-dipropylpropanamide (CID 2957681) is 3-(2,2-dimethyloxan-4-yl)-3-phenyl-N,N-dipropylpropanamide.
What is the SMILES notation for 3-(2,2-dimethyloxan-4-yl)-3-phenyl-N,N-dipropylpropanamide?
The canonical SMILES for 3-(2,2-dimethyloxan-4-yl)-3-phenyl-N,N-dipropylpropanamide is CCCN(CCC)C(=O)CC(c1ccccc1)C1CCOC(C)(C)C1.
What is the InChIKey of 3-(2,2-dimethyloxan-4-yl)-3-phenyl-N,N-dipropylpropanamide?
The InChIKey is XQPCADCBGDOLFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H35NO2/c1-5-13-23(14-6-2)21(24)16-20(18-10-8-7-9-11-18)19-12-15-25-22(3,4)17-19/h7-11,19-20H,5-6,12-17H2,1-4H3.
What are the key properties of 3-(2,2-dimethyloxan-4-yl)-3-phenyl-N,N-dipropylpropanamide?
3-(2,2-dimethyloxan-4-yl)-3-phenyl-N,N-dipropylpropanamide has a molecular weight of 345.53 g/mol, XLogP of 5.01, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dimethyloxan-4-yl)-3-phenyl-N,N-dipropylpropanamide is sourced from PubChem (CID 2957681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).