About N-[(4-chlorophenyl)methyl]-2-(1,3-diethyl-2,5-dioxoimidazolidin-4-yl)acetamide
N-[(4-chlorophenyl)methyl]-2-(1,3-diethyl-2,5-dioxoimidazolidin-4-yl)acetamide (PubChem CID 2958006) has the molecular formula C16H20ClN3O3
and a molecular weight of 337.81 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-(1,3-diethyl-2,5-dioxoimidazolidin-4-yl)acetamide.
Molecular Properties
| Compound Name | N-[(4-chlorophenyl)methyl]-2-(1,3-diethyl-2,5-dioxoimidazolidin-4-yl)acetamide |
| PubChem CID | 2958006 |
| Molecular Formula | C16H20ClN3O3 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-(1,3-diethyl-2,5-dioxoimidazolidin-4-yl)acetamide |
| SMILES | CCN1C(=O)C(CC(=O)NCc2ccc(Cl)cc2)N(CC)C1=O |
| InChI | InChI=1S/C16H20ClN3O3/c1-3-19-13(15(22)20(4-2)16(19)23)9-14(21)18-10-11-5-7-12(17)8-6-11/h5-8,13H,3-4,9-10H2,1-2H3,(H,18,21) |
| InChIKey | OBJFBMMWJFWKPO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze N-[(4-chlorophenyl)methyl]-2-(1,3-diethyl-2,5-dioxoimidazolidin-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-chlorophenyl)methyl]-2-(1,3-diethyl-2,5-dioxoimidazolidin-4-yl)acetamide?
The IUPAC name of N-[(4-chlorophenyl)methyl]-2-(1,3-diethyl-2,5-dioxoimidazolidin-4-yl)acetamide (CID 2958006) is N-[(4-chlorophenyl)methyl]-2-(1,3-diethyl-2,5-dioxoimidazolidin-4-yl)acetamide.
What is the SMILES notation for N-[(4-chlorophenyl)methyl]-2-(1,3-diethyl-2,5-dioxoimidazolidin-4-yl)acetamide?
The canonical SMILES for N-[(4-chlorophenyl)methyl]-2-(1,3-diethyl-2,5-dioxoimidazolidin-4-yl)acetamide is CCN1C(=O)C(CC(=O)NCc2ccc(Cl)cc2)N(CC)C1=O.
What is the InChIKey of N-[(4-chlorophenyl)methyl]-2-(1,3-diethyl-2,5-dioxoimidazolidin-4-yl)acetamide?
The InChIKey is OBJFBMMWJFWKPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20ClN3O3/c1-3-19-13(15(22)20(4-2)16(19)23)9-14(21)18-10-11-5-7-12(17)8-6-11/h5-8,13H,3-4,9-10H2,1-2H3,(H,18,21).
What are the key properties of N-[(4-chlorophenyl)methyl]-2-(1,3-diethyl-2,5-dioxoimidazolidin-4-yl)acetamide?
N-[(4-chlorophenyl)methyl]-2-(1,3-diethyl-2,5-dioxoimidazolidin-4-yl)acetamide has a molecular weight of 337.81 g/mol, XLogP of 2.02, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-chlorophenyl)methyl]-2-(1,3-diethyl-2,5-dioxoimidazolidin-4-yl)acetamide is sourced from PubChem (CID 2958006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).