C27H27N3O5 — CID 2958215
N-(4-methoxyphenyl)-1-[4-[[2-(4-nitrophenyl)acetyl]amino]phenyl]cyclopentane-1-carboxamide (PubChem CID 2958215) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-1-[4-[[2-(4-nitrophenyl)acetyl]amino]phenyl]cyclopentane-1-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-1-[4-[[2-(4-nitrophenyl)acetyl]amino]phenyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 2958215 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | N-(4-methoxyphenyl)-1-[4-[[2-(4-nitrophenyl)acetyl]amino]phenyl]cyclopentane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C2(c3ccc(NC(=O)Cc4ccc([N+](=O)[O-])cc4)cc3)CCCC2)cc1 |
| InChI | InChI=1S/C27H27N3O5/c1-35-24-14-10-22(11-15-24)29-26(32)27(16-2-3-17-27)20-6-8-21(9-7-20)28-25(31)18-19-4-12-23(13-5-19)30(33)34/h4-15H,2-3,16-18H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | BTXXASIVHUETHY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|