C16H21N2S+ — CID 29589
N,N-dimethyl-4-(3-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-2-yl)aniline (PubChem CID 29589) has the molecular formula C16H21N2S+ and a molecular weight of 273.43 g/mol. Its IUPAC name is N,N-dimethyl-4-(3-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-2-yl)aniline.
| Compound Name | N,N-dimethyl-4-(3-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-2-yl)aniline |
|---|---|
| PubChem CID | 29589 |
| Molecular Formula | C16H21N2S+ |
| Molecular Weight | 273.43 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | N,N-dimethyl-4-(3-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-2-yl)aniline |
| SMILES | CN(C)c1ccc(-c2sc3c([n+]2C)CCCC3)cc1 |
| InChI | InChI=1S/C16H21N2S/c1-17(2)13-10-8-12(9-11-13)16-18(3)14-6-4-5-7-15(14)19-16/h8-11H,4-7H2,1-3H3/q+1 |
| InChIKey | WROUHYMSVMPUNO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|