About N'-(2-methoxyethyl)-N-(2-piperazin-1-ylethyl)oxamide;hydrate
N'-(2-methoxyethyl)-N-(2-piperazin-1-ylethyl)oxamide;hydrate (PubChem CID 2959170) has the molecular formula C11H24N4O4
and a molecular weight of 276.34 g/mol. Its IUPAC name is N'-(2-methoxyethyl)-N-(2-piperazin-1-ylethyl)oxamide;hydrate.
Molecular Properties
| Compound Name | N'-(2-methoxyethyl)-N-(2-piperazin-1-ylethyl)oxamide;hydrate |
| PubChem CID | 2959170 |
| Molecular Formula | C11H24N4O4 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | N'-(2-methoxyethyl)-N-(2-piperazin-1-ylethyl)oxamide;hydrate |
| SMILES | COCCNC(=O)C(=O)NCCN1CCNCC1.O |
| InChI | InChI=1S/C11H22N4O3.H2O/c1-18-9-5-14-11(17)10(16)13-4-8-15-6-2-12-3-7-15;/h12H,2-9H2,1H3,(H,13,16)(H,14,17);1H2 |
| InChIKey | BZRYYUHOVAOUQC-UHFFFAOYSA-N |
| XLogP | -3.05 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-methoxyethyl)-N-(2-piperazin-1-ylethyl)oxamide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-methoxyethyl)-N-(2-piperazin-1-ylethyl)oxamide;hydrate?
The IUPAC name of N'-(2-methoxyethyl)-N-(2-piperazin-1-ylethyl)oxamide;hydrate (CID 2959170) is N'-(2-methoxyethyl)-N-(2-piperazin-1-ylethyl)oxamide;hydrate.
What is the SMILES notation for N'-(2-methoxyethyl)-N-(2-piperazin-1-ylethyl)oxamide;hydrate?
The canonical SMILES for N'-(2-methoxyethyl)-N-(2-piperazin-1-ylethyl)oxamide;hydrate is COCCNC(=O)C(=O)NCCN1CCNCC1.O.
What is the InChIKey of N'-(2-methoxyethyl)-N-(2-piperazin-1-ylethyl)oxamide;hydrate?
The InChIKey is BZRYYUHOVAOUQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N4O3.H2O/c1-18-9-5-14-11(17)10(16)13-4-8-15-6-2-12-3-7-15;/h12H,2-9H2,1H3,(H,13,16)(H,14,17);1H2.
What are the key properties of N'-(2-methoxyethyl)-N-(2-piperazin-1-ylethyl)oxamide;hydrate?
N'-(2-methoxyethyl)-N-(2-piperazin-1-ylethyl)oxamide;hydrate has a molecular weight of 276.34 g/mol, XLogP of -3.05, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-methoxyethyl)-N-(2-piperazin-1-ylethyl)oxamide;hydrate is sourced from PubChem (CID 2959170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).