C14H23N7OS — CID 2959773
2-[cyano-[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]amino]-N,N-diethylpropanamide (PubChem CID 2959773) has the molecular formula C14H23N7OS and a molecular weight of 337.45 g/mol. Its IUPAC name is 2-[cyano-[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]amino]-N,N-diethylpropanamide.
| Compound Name | 2-[cyano-[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 2959773 |
| Molecular Formula | C14H23N7OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 2-[cyano-[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)N(C#N)c1nc(SC)nc(N(C)C)n1 |
| InChI | InChI=1S/C14H23N7OS/c1-7-20(8-2)11(22)10(3)21(9-15)13-16-12(19(4)5)17-14(18-13)23-6/h10H,7-8H2,1-6H3 |
| InChIKey | AGZHAIUEUKCONM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 89.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|