C22H28N2O3S2 — CID 2959784
ethyl 2-(2-phenylethylcarbamothioylamino)-5-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate (PubChem CID 2959784) has the molecular formula C22H28N2O3S2 and a molecular weight of 432.61 g/mol. Its IUPAC name is ethyl 2-(2-phenylethylcarbamothioylamino)-5-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate.
| Compound Name | ethyl 2-(2-phenylethylcarbamothioylamino)-5-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate |
|---|---|
| PubChem CID | 2959784 |
| Molecular Formula | C22H28N2O3S2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | ethyl 2-(2-phenylethylcarbamothioylamino)-5-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)NCCc2ccccc2)sc2c1CC(C(C)C)OC2 |
| InChI | InChI=1S/C22H28N2O3S2/c1-4-26-21(25)19-16-12-17(14(2)3)27-13-18(16)29-20(19)24-22(28)23-11-10-15-8-6-5-7-9-15/h5-9,14,17H,4,10-13H2,1-3H3,(H2,23,24,28) |
| InChIKey | IDSHCXZAECMYSX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|