About [3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 2-phenylacetate
[3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 2-phenylacetate (PubChem CID 2960062) has the molecular formula C22H27NO10
and a molecular weight of 465.46 g/mol. Its IUPAC name is [3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 2-phenylacetate.
Molecular Properties
| Compound Name | [3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 2-phenylacetate |
| PubChem CID | 2960062 |
| Molecular Formula | C22H27NO10 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | [3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 2-phenylacetate |
| SMILES | CC(=O)NC1C(OC(=O)Cc2ccccc2)OC(COC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C22H27NO10/c1-12(24)23-19-21(31-15(4)27)20(30-14(3)26)17(11-29-13(2)25)32-22(19)33-18(28)10-16-8-6-5-7-9-16/h5-9,17,19-22H,10-11H2,1-4H3,(H,23,24) |
| InChIKey | IFFBJMVVZVNCMK-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 2-phenylacetate?
The IUPAC name of [3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 2-phenylacetate (CID 2960062) is [3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 2-phenylacetate.
What is the SMILES notation for [3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 2-phenylacetate?
The canonical SMILES for [3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 2-phenylacetate is CC(=O)NC1C(OC(=O)Cc2ccccc2)OC(COC(C)=O)C(OC(C)=O)C1OC(C)=O.
What is the InChIKey of [3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 2-phenylacetate?
The InChIKey is IFFBJMVVZVNCMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO10/c1-12(24)23-19-21(31-15(4)27)20(30-14(3)26)17(11-29-13(2)25)32-22(19)33-18(28)10-16-8-6-5-7-9-16/h5-9,17,19-22H,10-11H2,1-4H3,(H,23,24).
What are the key properties of [3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 2-phenylacetate?
[3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 2-phenylacetate has a molecular weight of 465.46 g/mol, XLogP of 0.43, 8 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 2-phenylacetate is sourced from PubChem (CID 2960062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).