C21H20N2OS — CID 2960446
6,9,11,11-tetramethylspiro[1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraene-3,2'-3H-1,3-benzothiazole]-2-one (PubChem CID 2960446) has the molecular formula C21H20N2OS and a molecular weight of 348.47 g/mol. Its IUPAC name is 6,9,11,11-tetramethylspiro[1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraene-3,2'-3H-1,3-benzothiazole]-2-one.
| Compound Name | 6,9,11,11-tetramethylspiro[1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraene-3,2'-3H-1,3-benzothiazole]-2-one |
|---|---|
| PubChem CID | 2960446 |
| Molecular Formula | C21H20N2OS |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 6,9,11,11-tetramethylspiro[1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraene-3,2'-3H-1,3-benzothiazole]-2-one |
| SMILES | CC1=CC(C)(C)N2C(=O)C3(Nc4ccccc4S3)c3cc(C)cc1c32 |
| InChI | InChI=1S/C21H20N2OS/c1-12-9-14-13(2)11-20(3,4)23-18(14)15(10-12)21(19(23)24)22-16-7-5-6-8-17(16)25-21/h5-11,22H,1-4H3 |
| InChIKey | PVOUHWGHLQPKJU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |