About 2-(2,5-dioxoimidazolidin-4-yl)-N-phenylacetamide
2-(2,5-dioxoimidazolidin-4-yl)-N-phenylacetamide (PubChem CID 2960513) has the molecular formula C11H11N3O3
and a molecular weight of 233.23 g/mol. Its IUPAC name is 2-(2,5-dioxoimidazolidin-4-yl)-N-phenylacetamide.
Molecular Properties
| Compound Name | 2-(2,5-dioxoimidazolidin-4-yl)-N-phenylacetamide |
| PubChem CID | 2960513 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 2-(2,5-dioxoimidazolidin-4-yl)-N-phenylacetamide |
| SMILES | O=C(CC1NC(=O)NC1=O)Nc1ccccc1 |
| InChI | InChI=1S/C11H11N3O3/c15-9(12-7-4-2-1-3-5-7)6-8-10(16)14-11(17)13-8/h1-5,8H,6H2,(H,12,15)(H2,13,14,16,17) |
| InChIKey | CLXCRCMVXJEEFP-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dioxoimidazolidin-4-yl)-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dioxoimidazolidin-4-yl)-N-phenylacetamide?
The IUPAC name of 2-(2,5-dioxoimidazolidin-4-yl)-N-phenylacetamide (CID 2960513) is 2-(2,5-dioxoimidazolidin-4-yl)-N-phenylacetamide.
What is the SMILES notation for 2-(2,5-dioxoimidazolidin-4-yl)-N-phenylacetamide?
The canonical SMILES for 2-(2,5-dioxoimidazolidin-4-yl)-N-phenylacetamide is O=C(CC1NC(=O)NC1=O)Nc1ccccc1.
What is the InChIKey of 2-(2,5-dioxoimidazolidin-4-yl)-N-phenylacetamide?
The InChIKey is CLXCRCMVXJEEFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O3/c15-9(12-7-4-2-1-3-5-7)6-8-10(16)14-11(17)13-8/h1-5,8H,6H2,(H,12,15)(H2,13,14,16,17).
What are the key properties of 2-(2,5-dioxoimidazolidin-4-yl)-N-phenylacetamide?
2-(2,5-dioxoimidazolidin-4-yl)-N-phenylacetamide has a molecular weight of 233.23 g/mol, XLogP of 0.22, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxoimidazolidin-4-yl)-N-phenylacetamide is sourced from PubChem (CID 2960513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).