C21H19N5O2S — CID 2960929
phenyl-[5-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]methanol (PubChem CID 2960929) has the molecular formula C21H19N5O2S and a molecular weight of 405.48 g/mol. Its IUPAC name is phenyl-[5-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]methanol.
| Compound Name | phenyl-[5-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 2960929 |
| Molecular Formula | C21H19N5O2S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | phenyl-[5-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]methanol |
| SMILES | C=CCn1c(SCc2nnc(-c3ccccc3)o2)nnc1C(O)c1ccccc1 |
| InChI | InChI=1S/C21H19N5O2S/c1-2-13-26-19(18(27)15-9-5-3-6-10-15)23-25-21(26)29-14-17-22-24-20(28-17)16-11-7-4-8-12-16/h2-12,18,27H,1,13-14H2 |
| InChIKey | JTFXQIYULLMLBX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|