C15H20F4N2 — CID 2961321
4-[3-(diethylamino)prop-1-enyl]-2,3,5,6-tetrafluoro-N,N-dimethylaniline (PubChem CID 2961321) has the molecular formula C15H20F4N2 and a molecular weight of 304.33 g/mol. Its IUPAC name is 4-[3-(diethylamino)prop-1-enyl]-2,3,5,6-tetrafluoro-N,N-dimethylaniline.
| Compound Name | 4-[3-(diethylamino)prop-1-enyl]-2,3,5,6-tetrafluoro-N,N-dimethylaniline |
|---|---|
| PubChem CID | 2961321 |
| Molecular Formula | C15H20F4N2 |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 4-[3-(diethylamino)prop-1-enyl]-2,3,5,6-tetrafluoro-N,N-dimethylaniline |
| SMILES | CCN(CC)CC=Cc1c(F)c(F)c(N(C)C)c(F)c1F |
| InChI | InChI=1S/C15H20F4N2/c1-5-21(6-2)9-7-8-10-11(16)13(18)15(20(3)4)14(19)12(10)17/h7-8H,5-6,9H2,1-4H3 |
| InChIKey | UTLRLYMNIMVTTR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|