About benzyl 6'-amino-5'-cyano-5-fluoro-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate
benzyl 6'-amino-5'-cyano-5-fluoro-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate (PubChem CID 2961977) has the molecular formula C22H16FN3O4
and a molecular weight of 405.39 g/mol. Its IUPAC name is benzyl 6'-amino-5'-cyano-5-fluoro-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate.
Molecular Properties
| Compound Name | benzyl 6'-amino-5'-cyano-5-fluoro-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate |
| PubChem CID | 2961977 |
| Molecular Formula | C22H16FN3O4 |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | benzyl 6'-amino-5'-cyano-5-fluoro-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate |
| SMILES | CC1=C(C(=O)OCc2ccccc2)C2(C(=O)Nc3ccc(F)cc32)C(C#N)=C(N)O1 |
| InChI | InChI=1S/C22H16FN3O4/c1-12-18(20(27)29-11-13-5-3-2-4-6-13)22(16(10-24)19(25)30-12)15-9-14(23)7-8-17(15)26-21(22)28/h2-9H,11,25H2,1H3,(H,26,28) |
| InChIKey | QFIRLRTVBMTGKU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzyl 6'-amino-5'-cyano-5-fluoro-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 6'-amino-5'-cyano-5-fluoro-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate?
The IUPAC name of benzyl 6'-amino-5'-cyano-5-fluoro-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate (CID 2961977) is benzyl 6'-amino-5'-cyano-5-fluoro-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate.
What is the SMILES notation for benzyl 6'-amino-5'-cyano-5-fluoro-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate?
The canonical SMILES for benzyl 6'-amino-5'-cyano-5-fluoro-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate is CC1=C(C(=O)OCc2ccccc2)C2(C(=O)Nc3ccc(F)cc32)C(C#N)=C(N)O1.
What is the InChIKey of benzyl 6'-amino-5'-cyano-5-fluoro-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate?
The InChIKey is QFIRLRTVBMTGKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16FN3O4/c1-12-18(20(27)29-11-13-5-3-2-4-6-13)22(16(10-24)19(25)30-12)15-9-14(23)7-8-17(15)26-21(22)28/h2-9H,11,25H2,1H3,(H,26,28).
What are the key properties of benzyl 6'-amino-5'-cyano-5-fluoro-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate?
benzyl 6'-amino-5'-cyano-5-fluoro-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate has a molecular weight of 405.39 g/mol, XLogP of 2.76, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 6'-amino-5'-cyano-5-fluoro-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate is sourced from PubChem (CID 2961977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).