3-(3-bromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid

C10H8BrNO3 — CID 2962252

IUPAC3-(3-bromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid
SMILESO=C(O)C1CC(c2cccc(Br)c2)=NO1
InChIInChI=1S/C10H8BrNO3/c11-7-3-1-2-6(4-7)8-5-9(10(13)14)15-12-8/h1-4,9H,5H2,(H,13,14)
InChIKeyPPLKIMIGZSEKTE-UHFFFAOYSA-N
MW270.08 g/mol
LogP2.03
Rot. Bonds2

About 3-(3-bromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid

3-(3-bromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid (PubChem CID 2962252) has the molecular formula C10H8BrNO3 and a molecular weight of 270.08 g/mol. Its IUPAC name is 3-(3-bromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(3-bromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid
PubChem CID2962252
Molecular FormulaC10H8BrNO3
Molecular Weight270.08 g/mol
Exact Mass268.97
IUPAC Name3-(3-bromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid
SMILESO=C(O)C1CC(c2cccc(Br)c2)=NO1
InChIInChI=1S/C10H8BrNO3/c11-7-3-1-2-6(4-7)8-5-9(10(13)14)15-12-8/h1-4,9H,5H2,(H,13,14)
InChIKeyPPLKIMIGZSEKTE-UHFFFAOYSA-N
XLogP2.03
TPSA58.89 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.08
LogP ≤ 52.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(3-bromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3-bromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-(3-bromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid (CID 2962252) is 3-(3-bromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-(3-bromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-(3-bromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid is O=C(O)C1CC(c2cccc(Br)c2)=NO1.
What is the InChIKey of 3-(3-bromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid?
The InChIKey is PPLKIMIGZSEKTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrNO3/c11-7-3-1-2-6(4-7)8-5-9(10(13)14)15-12-8/h1-4,9H,5H2,(H,13,14).
What are the key properties of 3-(3-bromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid?
3-(3-bromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid has a molecular weight of 270.08 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 2962252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).