C13H14F3N3O4 — CID 2962308
N-[1-butyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]furan-2-carboxamide (PubChem CID 2962308) has the molecular formula C13H14F3N3O4 and a molecular weight of 333.27 g/mol. Its IUPAC name is N-[1-butyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]furan-2-carboxamide.
| Compound Name | N-[1-butyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2962308 |
| Molecular Formula | C13H14F3N3O4 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-[1-butyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]furan-2-carboxamide |
| SMILES | CCCCN1C(=O)NC(NC(=O)c2ccco2)(C(F)(F)F)C1=O |
| InChI | InChI=1S/C13H14F3N3O4/c1-2-3-6-19-10(21)12(13(14,15)16,18-11(19)22)17-9(20)8-5-4-7-23-8/h4-5,7H,2-3,6H2,1H3,(H,17,20)(H,18,22) |
| InChIKey | WFQWNMDWYVPVFI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|