C13H19N5O3 — CID 2962707
1,3,7-trimethyl-8-(oxolan-2-ylmethylamino)purine-2,6-dione (PubChem CID 2962707) has the molecular formula C13H19N5O3 and a molecular weight of 293.33 g/mol. Its IUPAC name is 1,3,7-trimethyl-8-(oxolan-2-ylmethylamino)purine-2,6-dione.
| Compound Name | 1,3,7-trimethyl-8-(oxolan-2-ylmethylamino)purine-2,6-dione |
|---|---|
| PubChem CID | 2962707 |
| Molecular Formula | C13H19N5O3 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 1,3,7-trimethyl-8-(oxolan-2-ylmethylamino)purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(NCC3CCCO3)n2C)n(C)c1=O |
| InChI | InChI=1S/C13H19N5O3/c1-16-9-10(17(2)13(20)18(3)11(9)19)15-12(16)14-7-8-5-4-6-21-8/h8H,4-7H2,1-3H3,(H,14,15) |
| InChIKey | JSLHBFZXHVPNNU-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |