C28H25N3O7 — CID 2962720
ethyl 4-[3-[1,3-benzodioxol-5-ylmethyl(phenylcarbamoyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 2962720) has the molecular formula C28H25N3O7 and a molecular weight of 515.52 g/mol. Its IUPAC name is ethyl 4-[3-[1,3-benzodioxol-5-ylmethyl(phenylcarbamoyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[1,3-benzodioxol-5-ylmethyl(phenylcarbamoyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 2962720 |
| Molecular Formula | C28H25N3O7 |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | ethyl 4-[3-[1,3-benzodioxol-5-ylmethyl(phenylcarbamoyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(N(Cc3ccc4c(c3)OCO4)C(=O)Nc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C28H25N3O7/c1-2-36-27(34)19-9-11-21(12-10-19)31-25(32)15-22(26(31)33)30(28(35)29-20-6-4-3-5-7-20)16-18-8-13-23-24(14-18)38-17-37-23/h3-14,22H,2,15-17H2,1H3,(H,29,35) |
| InChIKey | LEXAKXVYFRRTCR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|