C22H28FN5O4 — CID 2963002
[4-[5-(4-ethylpiperazin-1-yl)-4-fluoro-2-nitrophenyl]-2-methylpiperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 2963002) has the molecular formula C22H28FN5O4 and a molecular weight of 445.50 g/mol. Its IUPAC name is [4-[5-(4-ethylpiperazin-1-yl)-4-fluoro-2-nitrophenyl]-2-methylpiperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-[5-(4-ethylpiperazin-1-yl)-4-fluoro-2-nitrophenyl]-2-methylpiperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 2963002 |
| Molecular Formula | C22H28FN5O4 |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | [4-[5-(4-ethylpiperazin-1-yl)-4-fluoro-2-nitrophenyl]-2-methylpiperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | CCN1CCN(c2cc(N3CCN(C(=O)c4ccco4)C(C)C3)c([N+](=O)[O-])cc2F)CC1 |
| InChI | InChI=1S/C22H28FN5O4/c1-3-24-6-8-25(9-7-24)18-14-19(20(28(30)31)13-17(18)23)26-10-11-27(16(2)15-26)22(29)21-5-4-12-32-21/h4-5,12-14,16H,3,6-11,15H2,1-2H3 |
| InChIKey | DWXPBZVQVPRFDQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 86.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|