C24H28N2O2 — CID 2963137
4-(4-benzylpiperidine-1-carbonyl)-1-(4-methylphenyl)pyrrolidin-2-one (PubChem CID 2963137) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 4-(4-benzylpiperidine-1-carbonyl)-1-(4-methylphenyl)pyrrolidin-2-one.
| Compound Name | 4-(4-benzylpiperidine-1-carbonyl)-1-(4-methylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 2963137 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 4-(4-benzylpiperidine-1-carbonyl)-1-(4-methylphenyl)pyrrolidin-2-one |
| SMILES | Cc1ccc(N2CC(C(=O)N3CCC(Cc4ccccc4)CC3)CC2=O)cc1 |
| InChI | InChI=1S/C24H28N2O2/c1-18-7-9-22(10-8-18)26-17-21(16-23(26)27)24(28)25-13-11-20(12-14-25)15-19-5-3-2-4-6-19/h2-10,20-21H,11-17H2,1H3 |
| InChIKey | OTHQSTWVBVJTQA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |