About (4S)-1-(furan-3-yl)-4,8-dimethylnonane-1,6-dione
(4S)-1-(furan-3-yl)-4,8-dimethylnonane-1,6-dione (PubChem CID 29632) has the molecular formula C15H22O3
and a molecular weight of 250.34 g/mol. Its IUPAC name is (4S)-1-(furan-3-yl)-4,8-dimethylnonane-1,6-dione.
Molecular Properties
| Compound Name | (4S)-1-(furan-3-yl)-4,8-dimethylnonane-1,6-dione |
| PubChem CID | 29632 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (4S)-1-(furan-3-yl)-4,8-dimethylnonane-1,6-dione |
| SMILES | CC(C)CC(=O)C[C@@H](C)CCC(=O)c1ccoc1 |
| InChI | InChI=1S/C15H22O3/c1-11(2)8-14(16)9-12(3)4-5-15(17)13-6-7-18-10-13/h6-7,10-12H,4-5,8-9H2,1-3H3/t12-/m0/s1 |
| InChIKey | IUEKVLLAZUXWTL-LBPRGKRZSA-N |
| XLogP | 3.88 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-1-(furan-3-yl)-4,8-dimethylnonane-1,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1-(furan-3-yl)-4,8-dimethylnonane-1,6-dione?
The IUPAC name of (4S)-1-(furan-3-yl)-4,8-dimethylnonane-1,6-dione (CID 29632) is (4S)-1-(furan-3-yl)-4,8-dimethylnonane-1,6-dione.
What is the SMILES notation for (4S)-1-(furan-3-yl)-4,8-dimethylnonane-1,6-dione?
The canonical SMILES for (4S)-1-(furan-3-yl)-4,8-dimethylnonane-1,6-dione is CC(C)CC(=O)C[C@@H](C)CCC(=O)c1ccoc1.
What is the InChIKey of (4S)-1-(furan-3-yl)-4,8-dimethylnonane-1,6-dione?
The InChIKey is IUEKVLLAZUXWTL-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H22O3/c1-11(2)8-14(16)9-12(3)4-5-15(17)13-6-7-18-10-13/h6-7,10-12H,4-5,8-9H2,1-3H3/t12-/m0/s1.
What are the key properties of (4S)-1-(furan-3-yl)-4,8-dimethylnonane-1,6-dione?
(4S)-1-(furan-3-yl)-4,8-dimethylnonane-1,6-dione has a molecular weight of 250.34 g/mol, XLogP of 3.88, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1-(furan-3-yl)-4,8-dimethylnonane-1,6-dione is sourced from PubChem (CID 29632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).