C15H22O3 — CID 29632
Myoporone (PubChem CID 29632) has the molecular formula C15H22O3 and a molecular weight of 250.33 g/mol. Its IUPAC name is (4S)-1-(furan-3-yl)-4,8-dimethylnonane-1,6-dione.
| Compound Name | Myoporone |
|---|---|
| PubChem CID | 29632 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (4S)-1-(furan-3-yl)-4,8-dimethylnonane-1,6-dione |
| SMILES | C[C@@H](CCC(=O)C1=COC=C1)CC(=O)CC(C)C |
| InChIKey | IUEKVLLAZUXWTL-LBPRGKRZSA-N |
| XLogP | 3.10 |
| TPSA | 47.30 Ų |
| H-Bond Donors | 0 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | 283 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |