About 1-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)urea
1-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)urea (PubChem CID 2963356) has the molecular formula C11H13ClN2O3S
and a molecular weight of 288.76 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)urea.
Molecular Properties
| Compound Name | 1-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)urea |
| PubChem CID | 2963356 |
| Molecular Formula | C11H13ClN2O3S |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)urea |
| SMILES | O=C(Nc1cccc(Cl)c1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H13ClN2O3S/c12-8-2-1-3-9(6-8)13-11(15)14-10-4-5-18(16,17)7-10/h1-3,6,10H,4-5,7H2,(H2,13,14,15) |
| InChIKey | MWZNRGCPIMCASS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)urea?
The IUPAC name of 1-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)urea (CID 2963356) is 1-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)urea.
What is the SMILES notation for 1-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)urea?
The canonical SMILES for 1-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)urea is O=C(Nc1cccc(Cl)c1)NC1CCS(=O)(=O)C1.
What is the InChIKey of 1-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)urea?
The InChIKey is MWZNRGCPIMCASS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN2O3S/c12-8-2-1-3-9(6-8)13-11(15)14-10-4-5-18(16,17)7-10/h1-3,6,10H,4-5,7H2,(H2,13,14,15).
What are the key properties of 1-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)urea?
1-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)urea has a molecular weight of 288.76 g/mol, XLogP of 1.65, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)urea is sourced from PubChem (CID 2963356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).