About N,4-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)benzenesulfonamide
N,4-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)benzenesulfonamide (PubChem CID 2963570) has the molecular formula C13H19NO4S2
and a molecular weight of 317.43 g/mol. Its IUPAC name is N,4-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | N,4-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)benzenesulfonamide |
| PubChem CID | 2963570 |
| Molecular Formula | C13H19NO4S2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | N,4-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C2(C)CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C13H19NO4S2/c1-11-4-6-12(7-5-11)20(17,18)14(3)13(2)8-9-19(15,16)10-13/h4-7H,8-10H2,1-3H3 |
| InChIKey | VBCGGXGGUSNJFB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,4-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)benzenesulfonamide?
The IUPAC name of N,4-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)benzenesulfonamide (CID 2963570) is N,4-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)benzenesulfonamide.
What is the SMILES notation for N,4-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)benzenesulfonamide?
The canonical SMILES for N,4-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)benzenesulfonamide is Cc1ccc(S(=O)(=O)N(C)C2(C)CCS(=O)(=O)C2)cc1.
What is the InChIKey of N,4-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)benzenesulfonamide?
The InChIKey is VBCGGXGGUSNJFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO4S2/c1-11-4-6-12(7-5-11)20(17,18)14(3)13(2)8-9-19(15,16)10-13/h4-7H,8-10H2,1-3H3.
What are the key properties of N,4-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)benzenesulfonamide?
N,4-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)benzenesulfonamide has a molecular weight of 317.43 g/mol, XLogP of 1.19, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)benzenesulfonamide is sourced from PubChem (CID 2963570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).