C28H24N2O7 — CID 2963589
2-[2-(3,4-dimethoxyphenyl)ethyl]-7-methyl-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 2963589) has the molecular formula C28H24N2O7 and a molecular weight of 500.51 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethyl]-7-methyl-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethyl]-7-methyl-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 2963589 |
| Molecular Formula | C28H24N2O7 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethyl]-7-methyl-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | COc1ccc(CCN2C(=O)c3oc4ccc(C)cc4c(=O)c3C2c2cccc([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C28H24N2O7/c1-16-7-9-21-20(13-16)26(31)24-25(18-5-4-6-19(15-18)30(33)34)29(28(32)27(24)37-21)12-11-17-8-10-22(35-2)23(14-17)36-3/h4-10,13-15,25H,11-12H2,1-3H3 |
| InChIKey | DGOCIBSWOLNDCS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 112.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|