C18H19N5OS — CID 2963610
2-[5-(oxan-2-ylmethylsulfanyl)-4-phenyl-1,2,4-triazol-3-yl]pyrazine (PubChem CID 2963610) has the molecular formula C18H19N5OS and a molecular weight of 353.45 g/mol. Its IUPAC name is 2-[5-(oxan-2-ylmethylsulfanyl)-4-phenyl-1,2,4-triazol-3-yl]pyrazine.
| Compound Name | 2-[5-(oxan-2-ylmethylsulfanyl)-4-phenyl-1,2,4-triazol-3-yl]pyrazine |
|---|---|
| PubChem CID | 2963610 |
| Molecular Formula | C18H19N5OS |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2-[5-(oxan-2-ylmethylsulfanyl)-4-phenyl-1,2,4-triazol-3-yl]pyrazine |
| SMILES | c1ccc(-n2c(SCC3CCCCO3)nnc2-c2cnccn2)cc1 |
| InChI | InChI=1S/C18H19N5OS/c1-2-6-14(7-3-1)23-17(16-12-19-9-10-20-16)21-22-18(23)25-13-15-8-4-5-11-24-15/h1-3,6-7,9-10,12,15H,4-5,8,11,13H2 |
| InChIKey | QIXVQJZUTWCWDK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |