About N-[1-(3,4-dimethoxyphenyl)ethyl]adamantane-1-carboxamide
N-[1-(3,4-dimethoxyphenyl)ethyl]adamantane-1-carboxamide (PubChem CID 2964280) has the molecular formula C21H29NO3
and a molecular weight of 343.47 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)ethyl]adamantane-1-carboxamide.
Molecular Properties
| Compound Name | N-[1-(3,4-dimethoxyphenyl)ethyl]adamantane-1-carboxamide |
| PubChem CID | 2964280 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)ethyl]adamantane-1-carboxamide |
| SMILES | COc1ccc(C(C)NC(=O)C23CC4CC(CC(C4)C2)C3)cc1OC |
| InChI | InChI=1S/C21H29NO3/c1-13(17-4-5-18(24-2)19(9-17)25-3)22-20(23)21-10-14-6-15(11-21)8-16(7-14)12-21/h4-5,9,13-16H,6-8,10-12H2,1-3H3,(H,22,23) |
| InChIKey | BESJGHIAONTJHR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(3,4-dimethoxyphenyl)ethyl]adamantane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(3,4-dimethoxyphenyl)ethyl]adamantane-1-carboxamide?
The IUPAC name of N-[1-(3,4-dimethoxyphenyl)ethyl]adamantane-1-carboxamide (CID 2964280) is N-[1-(3,4-dimethoxyphenyl)ethyl]adamantane-1-carboxamide.
What is the SMILES notation for N-[1-(3,4-dimethoxyphenyl)ethyl]adamantane-1-carboxamide?
The canonical SMILES for N-[1-(3,4-dimethoxyphenyl)ethyl]adamantane-1-carboxamide is COc1ccc(C(C)NC(=O)C23CC4CC(CC(C4)C2)C3)cc1OC.
What is the InChIKey of N-[1-(3,4-dimethoxyphenyl)ethyl]adamantane-1-carboxamide?
The InChIKey is BESJGHIAONTJHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29NO3/c1-13(17-4-5-18(24-2)19(9-17)25-3)22-20(23)21-10-14-6-15(11-21)8-16(7-14)12-21/h4-5,9,13-16H,6-8,10-12H2,1-3H3,(H,22,23).
What are the key properties of N-[1-(3,4-dimethoxyphenyl)ethyl]adamantane-1-carboxamide?
N-[1-(3,4-dimethoxyphenyl)ethyl]adamantane-1-carboxamide has a molecular weight of 343.47 g/mol, XLogP of 4.10, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(3,4-dimethoxyphenyl)ethyl]adamantane-1-carboxamide is sourced from PubChem (CID 2964280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).