C19H18BrN3O3 — CID 2964324
1-benzyl-N'-(4-bromobenzoyl)-5-oxopyrrolidine-3-carbohydrazide (PubChem CID 2964324) has the molecular formula C19H18BrN3O3 and a molecular weight of 416.28 g/mol. Its IUPAC name is 1-benzyl-N'-(4-bromobenzoyl)-5-oxopyrrolidine-3-carbohydrazide.
| Compound Name | 1-benzyl-N'-(4-bromobenzoyl)-5-oxopyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 2964324 |
| Molecular Formula | C19H18BrN3O3 |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 1-benzyl-N'-(4-bromobenzoyl)-5-oxopyrrolidine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CC(=O)N(Cc2ccccc2)C1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H18BrN3O3/c20-16-8-6-14(7-9-16)18(25)21-22-19(26)15-10-17(24)23(12-15)11-13-4-2-1-3-5-13/h1-9,15H,10-12H2,(H,21,25)(H,22,26) |
| InChIKey | PWAFCSJFUPMBPD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|