(4-fluorophenyl) 5-ethyl-3-methyl-1-benzofuran-2-carboxylate

C18H15FO3 — CID 2964614

IUPAC(4-fluorophenyl) 5-ethyl-3-methyl-1-benzofuran-2-carboxylate
SMILESCCc1ccc2oc(C(=O)Oc3ccc(F)cc3)c(C)c2c1
InChIInChI=1S/C18H15FO3/c1-3-12-4-9-16-15(10-12)11(2)17(22-16)18(20)21-14-7-5-13(19)6-8-14/h4-10H,3H2,1-2H3
InChIKeyWPBXZFRBLOVOKG-UHFFFAOYSA-N
MW298.31 g/mol
LogP4.66
Rot. Bonds3

About (4-fluorophenyl) 5-ethyl-3-methyl-1-benzofuran-2-carboxylate

(4-fluorophenyl) 5-ethyl-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 2964614) has the molecular formula C18H15FO3 and a molecular weight of 298.31 g/mol. Its IUPAC name is (4-fluorophenyl) 5-ethyl-3-methyl-1-benzofuran-2-carboxylate.

Molecular Properties

Compound Name(4-fluorophenyl) 5-ethyl-3-methyl-1-benzofuran-2-carboxylate
PubChem CID2964614
Molecular FormulaC18H15FO3
Molecular Weight298.31 g/mol
Exact Mass298.10
IUPAC Name(4-fluorophenyl) 5-ethyl-3-methyl-1-benzofuran-2-carboxylate
SMILESCCc1ccc2oc(C(=O)Oc3ccc(F)cc3)c(C)c2c1
InChIInChI=1S/C18H15FO3/c1-3-12-4-9-16-15(10-12)11(2)17(22-16)18(20)21-14-7-5-13(19)6-8-14/h4-10H,3H2,1-2H3
InChIKeyWPBXZFRBLOVOKG-UHFFFAOYSA-N
XLogP4.66
TPSA39.44 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.31
LogP ≤ 54.66
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (4-fluorophenyl) 5-ethyl-3-methyl-1-benzofuran-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-fluorophenyl) 5-ethyl-3-methyl-1-benzofuran-2-carboxylate?
The IUPAC name of (4-fluorophenyl) 5-ethyl-3-methyl-1-benzofuran-2-carboxylate (CID 2964614) is (4-fluorophenyl) 5-ethyl-3-methyl-1-benzofuran-2-carboxylate.
What is the SMILES notation for (4-fluorophenyl) 5-ethyl-3-methyl-1-benzofuran-2-carboxylate?
The canonical SMILES for (4-fluorophenyl) 5-ethyl-3-methyl-1-benzofuran-2-carboxylate is CCc1ccc2oc(C(=O)Oc3ccc(F)cc3)c(C)c2c1.
What is the InChIKey of (4-fluorophenyl) 5-ethyl-3-methyl-1-benzofuran-2-carboxylate?
The InChIKey is WPBXZFRBLOVOKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15FO3/c1-3-12-4-9-16-15(10-12)11(2)17(22-16)18(20)21-14-7-5-13(19)6-8-14/h4-10H,3H2,1-2H3.
What are the key properties of (4-fluorophenyl) 5-ethyl-3-methyl-1-benzofuran-2-carboxylate?
(4-fluorophenyl) 5-ethyl-3-methyl-1-benzofuran-2-carboxylate has a molecular weight of 298.31 g/mol, XLogP of 4.66, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl) 5-ethyl-3-methyl-1-benzofuran-2-carboxylate is sourced from PubChem (CID 2964614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).