C19H17IN2O4S — CID 2964691
2-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-N-(3-methoxyphenyl)acetamide (PubChem CID 2964691) has the molecular formula C19H17IN2O4S and a molecular weight of 496.33 g/mol. Its IUPAC name is 2-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2964691 |
| Molecular Formula | C19H17IN2O4S |
| Molecular Weight | 496.33 g/mol |
| Exact Mass | 496.00 |
| IUPAC Name | 2-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)CSC2CC(=O)N(c3ccc(I)cc3)C2=O)c1 |
| InChI | InChI=1S/C19H17IN2O4S/c1-26-15-4-2-3-13(9-15)21-17(23)11-27-16-10-18(24)22(19(16)25)14-7-5-12(20)6-8-14/h2-9,16H,10-11H2,1H3,(H,21,23) |
| InChIKey | RRCZEYNXOVZMKO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|