C18H22N2O5 — CID 2964886
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-(2,5-dioxopyrrolidin-1-yl)hexanamide (PubChem CID 2964886) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-(2,5-dioxopyrrolidin-1-yl)hexanamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-(2,5-dioxopyrrolidin-1-yl)hexanamide |
|---|---|
| PubChem CID | 2964886 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-(2,5-dioxopyrrolidin-1-yl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)CCC1=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H22N2O5/c21-16(4-2-1-3-9-20-17(22)7-8-18(20)23)19-13-5-6-14-15(12-13)25-11-10-24-14/h5-6,12H,1-4,7-11H2,(H,19,21) |
| InChIKey | FKQCZNQPCFSFBZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|