About (4-acetylphenyl) 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate
(4-acetylphenyl) 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate (PubChem CID 2965090) has the molecular formula C21H19NO7S
and a molecular weight of 429.45 g/mol. Its IUPAC name is (4-acetylphenyl) 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate.
Molecular Properties
| Compound Name | (4-acetylphenyl) 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate |
| PubChem CID | 2965090 |
| Molecular Formula | C21H19NO7S |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | (4-acetylphenyl) 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate |
| SMILES | CC(=O)c1ccc(OC(=O)C(CCS(C)(=O)=O)N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C21H19NO7S/c1-13(23)14-7-9-15(10-8-14)29-21(26)18(11-12-30(2,27)28)22-19(24)16-5-3-4-6-17(16)20(22)25/h3-10,18H,11-12H2,1-2H3 |
| InChIKey | ARPSZEXXEGETMP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 114.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (4-acetylphenyl) 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetylphenyl) 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate?
The IUPAC name of (4-acetylphenyl) 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate (CID 2965090) is (4-acetylphenyl) 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate.
What is the SMILES notation for (4-acetylphenyl) 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate?
The canonical SMILES for (4-acetylphenyl) 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate is CC(=O)c1ccc(OC(=O)C(CCS(C)(=O)=O)N2C(=O)c3ccccc3C2=O)cc1.
What is the InChIKey of (4-acetylphenyl) 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate?
The InChIKey is ARPSZEXXEGETMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19NO7S/c1-13(23)14-7-9-15(10-8-14)29-21(26)18(11-12-30(2,27)28)22-19(24)16-5-3-4-6-17(16)20(22)25/h3-10,18H,11-12H2,1-2H3.
What are the key properties of (4-acetylphenyl) 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate?
(4-acetylphenyl) 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate has a molecular weight of 429.45 g/mol, XLogP of 1.89, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetylphenyl) 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate is sourced from PubChem (CID 2965090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).