C10H10F3NO4S — CID 2965100
3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylpropane-1,2-diol (PubChem CID 2965100) has the molecular formula C10H10F3NO4S and a molecular weight of 297.25 g/mol. Its IUPAC name is 3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylpropane-1,2-diol.
| Compound Name | 3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 2965100 |
| Molecular Formula | C10H10F3NO4S |
| Molecular Weight | 297.25 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylpropane-1,2-diol |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1SCC(O)CO |
| InChI | InChI=1S/C10H10F3NO4S/c11-10(12,13)6-1-2-9(8(3-6)14(17)18)19-5-7(16)4-15/h1-3,7,15-16H,4-5H2 |
| InChIKey | ZVKVWGOPTNTEKZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|