C28H44N2O10 — CID 2965160
[2,4,5-triacetyloxy-1,6-bis(cycloheptylamino)-1,6-dioxohexan-3-yl] acetate (PubChem CID 2965160) has the molecular formula C28H44N2O10 and a molecular weight of 568.66 g/mol. Its IUPAC name is [2,4,5-triacetyloxy-1,6-bis(cycloheptylamino)-1,6-dioxohexan-3-yl] acetate.
| Compound Name | [2,4,5-triacetyloxy-1,6-bis(cycloheptylamino)-1,6-dioxohexan-3-yl] acetate |
|---|---|
| PubChem CID | 2965160 |
| Molecular Formula | C28H44N2O10 |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | [2,4,5-triacetyloxy-1,6-bis(cycloheptylamino)-1,6-dioxohexan-3-yl] acetate |
| SMILES | CC(=O)OC(C(=O)NC1CCCCCC1)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C28H44N2O10/c1-17(31)37-23(25(39-19(3)33)27(35)29-21-13-9-5-6-10-14-21)24(38-18(2)32)26(40-20(4)34)28(36)30-22-15-11-7-8-12-16-22/h21-26H,5-16H2,1-4H3,(H,29,35)(H,30,36) |
| InChIKey | XQZLNYADHFMINB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|