C23H25NO3 — CID 2965186
4-[2-(1-hydroxycyclohexyl)ethynyl]-N-[3-(1-hydroxyethyl)phenyl]benzamide (PubChem CID 2965186) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 4-[2-(1-hydroxycyclohexyl)ethynyl]-N-[3-(1-hydroxyethyl)phenyl]benzamide.
| Compound Name | 4-[2-(1-hydroxycyclohexyl)ethynyl]-N-[3-(1-hydroxyethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2965186 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 4-[2-(1-hydroxycyclohexyl)ethynyl]-N-[3-(1-hydroxyethyl)phenyl]benzamide |
| SMILES | CC(O)c1cccc(NC(=O)c2ccc(C#CC3(O)CCCCC3)cc2)c1 |
| InChI | InChI=1S/C23H25NO3/c1-17(25)20-6-5-7-21(16-20)24-22(26)19-10-8-18(9-11-19)12-15-23(27)13-3-2-4-14-23/h5-11,16-17,25,27H,2-4,13-14H2,1H3,(H,24,26) |
| InChIKey | JCYFSPBTFBQZMQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|