C23H24N2O — CID 2965693
[2-(4-propylphenyl)quinolin-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 2965693) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is [2-(4-propylphenyl)quinolin-4-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [2-(4-propylphenyl)quinolin-4-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 2965693 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | [2-(4-propylphenyl)quinolin-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | CCCc1ccc(-c2cc(C(=O)N3CCCC3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C23H24N2O/c1-2-7-17-10-12-18(13-11-17)22-16-20(23(26)25-14-5-6-15-25)19-8-3-4-9-21(19)24-22/h3-4,8-13,16H,2,5-7,14-15H2,1H3 |
| InChIKey | SQMZFJICMYAOKJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |