C17H12 — CID 29660
tetracyclo[7.6.2.05,17.012,16]heptadeca-1,3,5,7,9,12,14,16-octaene (PubChem CID 29660) has the molecular formula C17H12 and a molecular weight of 216.28 g/mol. Its IUPAC name is tetracyclo[7.6.2.05,17.012,16]heptadeca-1,3,5,7,9,12,14,16-octaene.
| Compound Name | tetracyclo[7.6.2.05,17.012,16]heptadeca-1,3,5,7,9,12,14,16-octaene |
|---|---|
| PubChem CID | 29660 |
| Molecular Formula | C17H12 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | tetracyclo[7.6.2.05,17.012,16]heptadeca-1,3,5,7,9,12,14,16-octaene |
| SMILES | C1=Cc2cccc3c2=c2c(cccc2=C1)CC=3 |
| InChI | InChI=1S/C17H12/c1-4-12-6-2-8-14-10-11-15-9-3-7-13(5-1)17(15)16(12)14/h1-10H,11H2 |
| InChIKey | MZJKHQKKQFRCFR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |